C28H35ClN2O5S — CID 166675057
(3R,6S,22S)-22-(4-chloro-2-ethylphenyl)-13,13-dioxo-10,20-dioxa-13λ6-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-16(25),17,19(24)-trien-15-one (PubChem CID 166675057) has the molecular formula C28H35ClN2O5S and a molecular weight of 547.12 g/mol. Its IUPAC name is (3R,6S,22S)-22-(4-chloro-2-ethylphenyl)-13,13-dioxo-10,20-dioxa-13λ6-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-16(25),17,19(24)-trien-15-one.
| Compound Name | (3R,6S,22S)-22-(4-chloro-2-ethylphenyl)-13,13-dioxo-10,20-dioxa-13λ6-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-16(25),17,19(24)-trien-15-one |
|---|---|
| PubChem CID | 166675057 |
| Molecular Formula | C28H35ClN2O5S |
| Molecular Weight | 547.12 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | (3R,6S,22S)-22-(4-chloro-2-ethylphenyl)-13,13-dioxo-10,20-dioxa-13λ6-thia-1,14-diazatetracyclo[14.7.2.03,6.019,24]pentacosa-16(25),17,19(24)-trien-15-one |
| SMILES | CCc1cc(Cl)ccc1[C@@H]1COc2ccc3cc2N(C1)C[C@@H]1CC[C@H]1CCCOCCS(=O)(=O)NC3=O |
| InChI | InChI=1S/C28H35ClN2O5S/c1-2-19-14-24(29)8-9-25(19)23-17-31-16-22-6-5-20(22)4-3-11-35-12-13-37(33,34)30-28(32)21-7-10-27(36-18-23)26(31)15-21/h7-10,14-15,20,22-23H,2-6,11-13,16-18H2,1H3,(H,30,32)/t20-,22+,23+/m1/s1 |
| InChIKey | WAYGCIOKDVXGDT-PUHATCMVSA-N |
| XLogP | 4.78 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.12 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |