About manganese(2+);bis(methanidyl(trimethyl)silane)
manganese(2+);bis(methanidyl(trimethyl)silane) (PubChem CID 16667517) has the molecular formula C8H22MnSi2
and a molecular weight of 229.37 g/mol. Its IUPAC name is manganese(2+);bis(methanidyl(trimethyl)silane).
Molecular Properties
| Compound Name | manganese(2+);bis(methanidyl(trimethyl)silane) |
| PubChem CID | 16667517 |
| Molecular Formula | C8H22MnSi2 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | manganese(2+);bis(methanidyl(trimethyl)silane) |
| SMILES | [CH2-][Si](C)(C)C.[CH2-][Si](C)(C)C.[Mn+2] |
| InChI | InChI=1S/2C4H11Si.Mn/c2*1-5(2,3)4;/h2*1H2,2-4H3;/q2*-1;+2 |
| InChIKey | OPGQAISFTWUVPT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze manganese(2+);bis(methanidyl(trimethyl)silane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);bis(methanidyl(trimethyl)silane)?
The IUPAC name of manganese(2+);bis(methanidyl(trimethyl)silane) (CID 16667517) is manganese(2+);bis(methanidyl(trimethyl)silane).
What is the SMILES notation for manganese(2+);bis(methanidyl(trimethyl)silane)?
The canonical SMILES for manganese(2+);bis(methanidyl(trimethyl)silane) is [CH2-][Si](C)(C)C.[CH2-][Si](C)(C)C.[Mn+2].
What is the InChIKey of manganese(2+);bis(methanidyl(trimethyl)silane)?
The InChIKey is OPGQAISFTWUVPT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H11Si.Mn/c2*1-5(2,3)4;/h2*1H2,2-4H3;/q2*-1;+2.
What are the key properties of manganese(2+);bis(methanidyl(trimethyl)silane)?
manganese(2+);bis(methanidyl(trimethyl)silane) has a molecular weight of 229.37 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);bis(methanidyl(trimethyl)silane) is sourced from PubChem (CID 16667517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).