About magnesium;methanidyl(trimethyl)silane;pentane
magnesium;methanidyl(trimethyl)silane;pentane (PubChem CID 19977373) has the molecular formula C9H22MgSi
and a molecular weight of 182.67 g/mol. Its IUPAC name is magnesium;methanidyl(trimethyl)silane;pentane.
Molecular Properties
| Compound Name | magnesium;methanidyl(trimethyl)silane;pentane |
| PubChem CID | 19977373 |
| Molecular Formula | C9H22MgSi |
| Molecular Weight | 182.67 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | magnesium;methanidyl(trimethyl)silane;pentane |
| SMILES | [CH2-]CCCC.[CH2-][Si](C)(C)C.[Mg+2] |
| InChI | InChI=1S/C5H11.C4H11Si.Mg/c1-3-5-4-2;1-5(2,3)4;/h1,3-5H2,2H3;1H2,2-4H3;/q2*-1;+2 |
| InChIKey | XUASJSWAKSYQPE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.67 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze magnesium;methanidyl(trimethyl)silane;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;methanidyl(trimethyl)silane;pentane?
The IUPAC name of magnesium;methanidyl(trimethyl)silane;pentane (CID 19977373) is magnesium;methanidyl(trimethyl)silane;pentane.
What is the SMILES notation for magnesium;methanidyl(trimethyl)silane;pentane?
The canonical SMILES for magnesium;methanidyl(trimethyl)silane;pentane is [CH2-]CCCC.[CH2-][Si](C)(C)C.[Mg+2].
What is the InChIKey of magnesium;methanidyl(trimethyl)silane;pentane?
The InChIKey is XUASJSWAKSYQPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11.C4H11Si.Mg/c1-3-5-4-2;1-5(2,3)4;/h1,3-5H2,2H3;1H2,2-4H3;/q2*-1;+2.
What are the key properties of magnesium;methanidyl(trimethyl)silane;pentane?
magnesium;methanidyl(trimethyl)silane;pentane has a molecular weight of 182.67 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;methanidyl(trimethyl)silane;pentane is sourced from PubChem (CID 19977373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).