About dichlorotitanium;bis(pentane)
dichlorotitanium;bis(pentane) (PubChem CID 18688492) has the molecular formula C10H22Cl2Ti-2
and a molecular weight of 261.06 g/mol. Its IUPAC name is dichlorotitanium;bis(pentane).
Molecular Properties
| Compound Name | dichlorotitanium;bis(pentane) |
| PubChem CID | 18688492 |
| Molecular Formula | C10H22Cl2Ti-2 |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | dichlorotitanium;bis(pentane) |
| SMILES | Cl[Ti]Cl.[CH2-]CCCC.[CH2-]CCCC |
| InChI | InChI=1S/2C5H11.2ClH.Ti/c2*1-3-5-4-2;;;/h2*1,3-5H2,2H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | MMFJDROQULBVPZ-UHFFFAOYSA-L |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorotitanium;bis(pentane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotitanium;bis(pentane)?
The IUPAC name of dichlorotitanium;bis(pentane) (CID 18688492) is dichlorotitanium;bis(pentane).
What is the SMILES notation for dichlorotitanium;bis(pentane)?
The canonical SMILES for dichlorotitanium;bis(pentane) is Cl[Ti]Cl.[CH2-]CCCC.[CH2-]CCCC.
What is the InChIKey of dichlorotitanium;bis(pentane)?
The InChIKey is MMFJDROQULBVPZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H11.2ClH.Ti/c2*1-3-5-4-2;;;/h2*1,3-5H2,2H3;2*1H;/q2*-1;;;+2/p-2.
What are the key properties of dichlorotitanium;bis(pentane)?
dichlorotitanium;bis(pentane) has a molecular weight of 261.06 g/mol, XLogP of 5.40, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotitanium;bis(pentane) is sourced from PubChem (CID 18688492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).