About butane;dichlorotitanium
butane;dichlorotitanium (PubChem CID 12072857) has the molecular formula C8H18Cl2Ti-2
and a molecular weight of 233.00 g/mol. Its IUPAC name is butane;dichlorotitanium.
Molecular Properties
| Compound Name | butane;dichlorotitanium |
| PubChem CID | 12072857 |
| Molecular Formula | C8H18Cl2Ti-2 |
| Molecular Weight | 233.00 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | butane;dichlorotitanium |
| SMILES | Cl[Ti]Cl.[CH2-]CCC.[CH2-]CCC |
| InChI | InChI=1S/2C4H9.2ClH.Ti/c2*1-3-4-2;;;/h2*1,3-4H2,2H3;2*1H;/q2*-1;;;+2/p-2 |
| InChIKey | MXXZBMDFOZKODG-UHFFFAOYSA-L |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.00 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze butane;dichlorotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;dichlorotitanium?
The IUPAC name of butane;dichlorotitanium (CID 12072857) is butane;dichlorotitanium.
What is the SMILES notation for butane;dichlorotitanium?
The canonical SMILES for butane;dichlorotitanium is Cl[Ti]Cl.[CH2-]CCC.[CH2-]CCC.
What is the InChIKey of butane;dichlorotitanium?
The InChIKey is MXXZBMDFOZKODG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H9.2ClH.Ti/c2*1-3-4-2;;;/h2*1,3-4H2,2H3;2*1H;/q2*-1;;;+2/p-2.
What are the key properties of butane;dichlorotitanium?
butane;dichlorotitanium has a molecular weight of 233.00 g/mol, XLogP of 4.62, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;dichlorotitanium is sourced from PubChem (CID 12072857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).