C21H27F2N2O4S2- — CID 166676596
CID 166676596 (PubChem CID 166676596) has the molecular formula C21H27F2N2O4S2- and a molecular weight of 473.59 g/mol.
| Compound Name | CID 166676596 |
|---|---|
| PubChem CID | 166676596 |
| Molecular Formula | C21H27F2N2O4S2- |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(OC(F)F)cc(C(C)C)c1CC(=O)/N=[S-](=O)/c1cnc(C(C)(C)O)s1 |
| InChI | InChI=1S/C21H27F2N2O4S2/c1-11(2)14-7-13(29-20(22)23)8-15(12(3)4)16(14)9-17(26)25-31(28)18-10-24-19(30-18)21(5,6)27/h7-8,10-12,20,27H,9H2,1-6H3/q-1 |
| InChIKey | LLNLYXIKVVQCSL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|