C18H22F3NO — CID 166677755
(10S)-4-methoxy-17-(trifluoromethyl)-17-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 166677755) has the molecular formula C18H22F3NO and a molecular weight of 325.37 g/mol. Its IUPAC name is (10S)-4-methoxy-17-(trifluoromethyl)-17-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (10S)-4-methoxy-17-(trifluoromethyl)-17-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 166677755 |
| Molecular Formula | C18H22F3NO |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (10S)-4-methoxy-17-(trifluoromethyl)-17-azatetracyclo[8.4.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)C13CCCC[C@@]1(CC2)N(C(F)(F)F)CC3 |
| InChI | InChI=1S/C18H22F3NO/c1-23-14-5-4-13-6-9-17-8-3-2-7-16(17,15(13)12-14)10-11-22(17)18(19,20)21/h4-5,12H,2-3,6-11H2,1H3/t16?,17-/m0/s1 |
| InChIKey | VUKUBRKSMYWSRR-DJNXLDHESA-N |
| XLogP | 4.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|