C19H20F3NO3 — CID 21441708
2,2,2-trifluoro-1-(4-methoxy-11-oxa-18-azapentacyclo[7.6.3.01,10.02,7.010,12]octadeca-2(7),3,5-trien-18-yl)ethanone (PubChem CID 21441708) has the molecular formula C19H20F3NO3 and a molecular weight of 367.37 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-methoxy-11-oxa-18-azapentacyclo[7.6.3.01,10.02,7.010,12]octadeca-2(7),3,5-trien-18-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(4-methoxy-11-oxa-18-azapentacyclo[7.6.3.01,10.02,7.010,12]octadeca-2(7),3,5-trien-18-yl)ethanone |
|---|---|
| PubChem CID | 21441708 |
| Molecular Formula | C19H20F3NO3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-methoxy-11-oxa-18-azapentacyclo[7.6.3.01,10.02,7.010,12]octadeca-2(7),3,5-trien-18-yl)ethanone |
| SMILES | COc1ccc2c(c1)C13CCCC4OC41C(C2)N(C(=O)C(F)(F)F)CC3 |
| InChI | InChI=1S/C19H20F3NO3/c1-25-12-5-4-11-9-14-18-15(26-18)3-2-6-17(18,13(11)10-12)7-8-23(14)16(24)19(20,21)22/h4-5,10,14-15H,2-3,6-9H2,1H3 |
| InChIKey | CLHJHEQLLOFWIT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|