C24H34N2O — CID 144696246
(3R)-20-(cyclopropylmethyl)-15-methoxy-5,20-diazapentacyclo[8.7.3.13,9.01,9.012,17]henicosa-12(17),13,15-triene (PubChem CID 144696246) has the molecular formula C24H34N2O and a molecular weight of 366.55 g/mol. Its IUPAC name is (3R)-20-(cyclopropylmethyl)-15-methoxy-5,20-diazapentacyclo[8.7.3.13,9.01,9.012,17]henicosa-12(17),13,15-triene.
| Compound Name | (3R)-20-(cyclopropylmethyl)-15-methoxy-5,20-diazapentacyclo[8.7.3.13,9.01,9.012,17]henicosa-12(17),13,15-triene |
|---|---|
| PubChem CID | 144696246 |
| Molecular Formula | C24H34N2O |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | (3R)-20-(cyclopropylmethyl)-15-methoxy-5,20-diazapentacyclo[8.7.3.13,9.01,9.012,17]henicosa-12(17),13,15-triene |
| SMILES | COc1ccc2c(c1)C13CCN(CC4CC4)C(C2)C12CCCNC[C@H](C3)C2 |
| InChI | InChI=1S/C24H34N2O/c1-27-20-6-5-19-11-22-24-7-2-9-25-15-18(14-24)13-23(24,21(19)12-20)8-10-26(22)16-17-3-4-17/h5-6,12,17-18,22,25H,2-4,7-11,13-16H2,1H3/t18-,22?,23?,24?/m1/s1 |
| InChIKey | YYVMMHRZXKSELE-COJDMCMLSA-N |
| XLogP | 3.75 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |