C26H38N2O2 — CID 126497274
(1R,9R,10S)-17-(cyclopropylmethyl)-10-ethyl-4-methoxy-13-pyrrolidin-1-yl-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 126497274) has the molecular formula C26H38N2O2 and a molecular weight of 410.60 g/mol. Its IUPAC name is (1R,9R,10S)-17-(cyclopropylmethyl)-10-ethyl-4-methoxy-13-pyrrolidin-1-yl-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1R,9R,10S)-17-(cyclopropylmethyl)-10-ethyl-4-methoxy-13-pyrrolidin-1-yl-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 126497274 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | (1R,9R,10S)-17-(cyclopropylmethyl)-10-ethyl-4-methoxy-13-pyrrolidin-1-yl-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | CC[C@]12OCC(N3CCCC3)C[C@@]13CCN(CC1CC1)[C@@H]2Cc1ccc(OC)cc13 |
| InChI | InChI=1S/C26H38N2O2/c1-3-26-24-14-20-8-9-22(29-2)15-23(20)25(26,10-13-28(24)17-19-6-7-19)16-21(18-30-26)27-11-4-5-12-27/h8-9,15,19,21,24H,3-7,10-14,16-18H2,1-2H3/t21?,24-,25-,26-/m1/s1 |
| InChIKey | NXSTXFYBNLWVJO-ZSZFIPSZSA-N |
| XLogP | 4.01 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |