C27H38N2O3 — CID 126497333
N-[2-[(1S,9R,13S)-10-(cyclopropylmethyl)-4-methoxyspiro[10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13,2'-oxane]-1-yl]ethyl]cyclopropanecarboxamide (PubChem CID 126497333) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is N-[2-[(1S,9R,13S)-10-(cyclopropylmethyl)-4-methoxyspiro[10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13,2'-oxane]-1-yl]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[(1S,9R,13S)-10-(cyclopropylmethyl)-4-methoxyspiro[10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13,2'-oxane]-1-yl]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 126497333 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | N-[2-[(1S,9R,13S)-10-(cyclopropylmethyl)-4-methoxyspiro[10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13,2'-oxane]-1-yl]ethyl]cyclopropanecarboxamide |
| SMILES | COc1ccc2c(c1)[C@]1(CCNC(=O)C3CC3)CCN(CC3CC3)[C@H](C2)[C@]12CCCCO2 |
| InChI | InChI=1S/C27H38N2O3/c1-31-22-9-8-21-16-24-27(10-2-3-15-32-27)26(23(21)17-22,11-13-28-25(30)20-6-7-20)12-14-29(24)18-19-4-5-19/h8-9,17,19-20,24H,2-7,10-16,18H2,1H3,(H,28,30)/t24-,26+,27-/m1/s1 |
| InChIKey | BPMOFUVTKSTPOA-FXVJXKIMSA-N |
| XLogP | 3.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |