C22H31NO3 — CID 22077265
N-[2-(10a-hydroxy-6-methoxy-1,2,3,4,9,10-hexahydrophenanthren-4a-yl)ethyl]cyclobutanecarboxamide (PubChem CID 22077265) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is N-[2-(10a-hydroxy-6-methoxy-1,2,3,4,9,10-hexahydrophenanthren-4a-yl)ethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-(10a-hydroxy-6-methoxy-1,2,3,4,9,10-hexahydrophenanthren-4a-yl)ethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 22077265 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | N-[2-(10a-hydroxy-6-methoxy-1,2,3,4,9,10-hexahydrophenanthren-4a-yl)ethyl]cyclobutanecarboxamide |
| SMILES | COc1ccc2c(c1)C1(CCNC(=O)C3CCC3)CCCCC1(O)CC2 |
| InChI | InChI=1S/C22H31NO3/c1-26-18-8-7-16-9-12-22(25)11-3-2-10-21(22,19(16)15-18)13-14-23-20(24)17-5-4-6-17/h7-8,15,17,25H,2-6,9-14H2,1H3,(H,23,24) |
| InChIKey | JTOAQFJCTYUVMZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |