C19H29NO2 — CID 57247370
(4bS,8aR)-4b-[2-(dimethylamino)ethyl]-3-methoxy-5,6,7,8,9,10-hexahydrophenanthren-8a-ol (PubChem CID 57247370) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (4bS,8aR)-4b-[2-(dimethylamino)ethyl]-3-methoxy-5,6,7,8,9,10-hexahydrophenanthren-8a-ol.
| Compound Name | (4bS,8aR)-4b-[2-(dimethylamino)ethyl]-3-methoxy-5,6,7,8,9,10-hexahydrophenanthren-8a-ol |
|---|---|
| PubChem CID | 57247370 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (4bS,8aR)-4b-[2-(dimethylamino)ethyl]-3-methoxy-5,6,7,8,9,10-hexahydrophenanthren-8a-ol |
| SMILES | COc1ccc2c(c1)[C@@]1(CCN(C)C)CCCC[C@@]1(O)CC2 |
| InChI | InChI=1S/C19H29NO2/c1-20(2)13-12-18-9-4-5-10-19(18,21)11-8-15-6-7-16(22-3)14-17(15)18/h6-7,14,21H,4-5,8-13H2,1-3H3/t18-,19+/m0/s1 |
| InChIKey | YZTSLTGXONKIMK-RBUKOAKNSA-N |
| XLogP | 3.14 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |