C26H33NO3 — CID 57267021
N-[2-[(4aS,10aR)-10a-hydroxy-6-phenylmethoxy-1,2,3,4,9,10-hexahydrophenanthren-4a-yl]ethyl]propanamide (PubChem CID 57267021) has the molecular formula C26H33NO3 and a molecular weight of 407.55 g/mol. Its IUPAC name is N-[2-[(4aS,10aR)-10a-hydroxy-6-phenylmethoxy-1,2,3,4,9,10-hexahydrophenanthren-4a-yl]ethyl]propanamide.
| Compound Name | N-[2-[(4aS,10aR)-10a-hydroxy-6-phenylmethoxy-1,2,3,4,9,10-hexahydrophenanthren-4a-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 57267021 |
| Molecular Formula | C26H33NO3 |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | N-[2-[(4aS,10aR)-10a-hydroxy-6-phenylmethoxy-1,2,3,4,9,10-hexahydrophenanthren-4a-yl]ethyl]propanamide |
| SMILES | CCC(=O)NCC[C@]12CCCC[C@@]1(O)CCc1ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C26H33NO3/c1-2-24(28)27-17-16-25-13-6-7-14-26(25,29)15-12-21-10-11-22(18-23(21)25)30-19-20-8-4-3-5-9-20/h3-5,8-11,18,29H,2,6-7,12-17,19H2,1H3,(H,27,28)/t25-,26+/m0/s1 |
| InChIKey | DKKGLQUKTYHYKZ-IZZNHLLZSA-N |
| XLogP | 4.67 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |