C25H33NO4S — CID 174147052
tert-butyl-[[1-(2-ethoxy-2-oxoethyl)-7-phenylmethoxy-3,4-dihydro-2H-naphthalen-1-yl]amino]-oxidosulfanium (PubChem CID 174147052) has the molecular formula C25H33NO4S and a molecular weight of 443.61 g/mol. Its IUPAC name is tert-butyl-[[1-(2-ethoxy-2-oxoethyl)-7-phenylmethoxy-3,4-dihydro-2H-naphthalen-1-yl]amino]-oxidosulfanium.
| Compound Name | tert-butyl-[[1-(2-ethoxy-2-oxoethyl)-7-phenylmethoxy-3,4-dihydro-2H-naphthalen-1-yl]amino]-oxidosulfanium |
|---|---|
| PubChem CID | 174147052 |
| Molecular Formula | C25H33NO4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | tert-butyl-[[1-(2-ethoxy-2-oxoethyl)-7-phenylmethoxy-3,4-dihydro-2H-naphthalen-1-yl]amino]-oxidosulfanium |
| SMILES | CCOC(=O)CC1(N[S+]([O-])C(C)(C)C)CCCc2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C25H33NO4S/c1-5-29-23(27)17-25(26-31(28)24(2,3)4)15-9-12-20-13-14-21(16-22(20)25)30-18-19-10-7-6-8-11-19/h6-8,10-11,13-14,16,26H,5,9,12,15,17-18H2,1-4H3 |
| InChIKey | MXFFZKDQLPFOSD-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 70.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|