C24H36N2O2 — CID 126497229
(1R,9R,10S)-17-(cyclopropylmethyl)-10-ethyl-4-methoxy-N,N-dimethyl-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-amine (PubChem CID 126497229) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is (1R,9R,10S)-17-(cyclopropylmethyl)-10-ethyl-4-methoxy-N,N-dimethyl-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-amine.
| Compound Name | (1R,9R,10S)-17-(cyclopropylmethyl)-10-ethyl-4-methoxy-N,N-dimethyl-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-amine |
|---|---|
| PubChem CID | 126497229 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | (1R,9R,10S)-17-(cyclopropylmethyl)-10-ethyl-4-methoxy-N,N-dimethyl-11-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-amine |
| SMILES | CC[C@]12OCC(N(C)C)C[C@@]13CCN(CC1CC1)[C@@H]2Cc1ccc(OC)cc13 |
| InChI | InChI=1S/C24H36N2O2/c1-5-24-22-12-18-8-9-20(27-4)13-21(18)23(24,14-19(16-28-24)25(2)3)10-11-26(22)15-17-6-7-17/h8-9,13,17,19,22H,5-7,10-12,14-16H2,1-4H3/t19?,22-,23-,24-/m1/s1 |
| InChIKey | MCEWENUIVGDERF-RDJJLVMJSA-N |
| XLogP | 3.47 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |