C22H25F3N2O2 — CID 151008818
2,2,2-trifluoro-1-[(1R,3S,9S,10R)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-20-yl]ethanone (PubChem CID 151008818) has the molecular formula C22H25F3N2O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[(1R,3S,9S,10R)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-20-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[(1R,3S,9S,10R)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-20-yl]ethanone |
|---|---|
| PubChem CID | 151008818 |
| Molecular Formula | C22H25F3N2O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2,2,2-trifluoro-1-[(1R,3S,9S,10R)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-20-yl]ethanone |
| SMILES | COc1ccc2c(c1)[C@]13CCN(C(=O)C(F)(F)F)[C@H](C2)[C@]12CCC1NC[C@@H](C2)C13 |
| InChI | InChI=1S/C22H25F3N2O2/c1-29-14-3-2-12-8-17-20-5-4-16-18(13(10-20)11-26-16)21(20,15(12)9-14)6-7-27(17)19(28)22(23,24)25/h2-3,9,13,16-18,26H,4-8,10-11H2,1H3/t13-,16?,17-,18?,20-,21+/m1/s1 |
| InChIKey | LVQSRQYCVNJZDU-VSLYDHSBSA-N |
| XLogP | 3.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |