C41H53N3O2Si — CID 144696232
[(3S)-20-(3-anilinopropyl)-15-[tert-butyl(dimethyl)silyl]oxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone (PubChem CID 144696232) has the molecular formula C41H53N3O2Si and a molecular weight of 647.98 g/mol. Its IUPAC name is [(3S)-20-(3-anilinopropyl)-15-[tert-butyl(dimethyl)silyl]oxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone.
| Compound Name | [(3S)-20-(3-anilinopropyl)-15-[tert-butyl(dimethyl)silyl]oxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 144696232 |
| Molecular Formula | C41H53N3O2Si |
| Molecular Weight | 647.98 g/mol |
| Exact Mass | 647.39 |
| IUPAC Name | [(3S)-20-(3-anilinopropyl)-15-[tert-butyl(dimethyl)silyl]oxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)C13CCN(CCCNc4ccccc4)C(C2)C12CCC1C3[C@@H](CN1C(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C41H53N3O2Si/c1-39(2,3)47(4,5)46-33-18-17-30-25-36-40-20-19-35-37(31(27-40)28-44(35)38(45)29-13-8-6-9-14-29)41(40,34(30)26-33)21-24-43(36)23-12-22-42-32-15-10-7-11-16-32/h6-11,13-18,26,31,35-37,42H,12,19-25,27-28H2,1-5H3/t31-,35?,36?,37?,40?,41?/m1/s1 |
| InChIKey | LUVQPUNOYJPNMF-HTTZUSHQSA-N |
| XLogP | 8.38 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.98 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|