C42H54N2O2Si — CID 146833521
[(3S)-15-[tert-butyl(dimethyl)silyl]oxy-20-(4-phenylbutyl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone (PubChem CID 146833521) has the molecular formula C42H54N2O2Si and a molecular weight of 646.99 g/mol. Its IUPAC name is [(3S)-15-[tert-butyl(dimethyl)silyl]oxy-20-(4-phenylbutyl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone.
| Compound Name | [(3S)-15-[tert-butyl(dimethyl)silyl]oxy-20-(4-phenylbutyl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 146833521 |
| Molecular Formula | C42H54N2O2Si |
| Molecular Weight | 646.99 g/mol |
| Exact Mass | 646.40 |
| IUPAC Name | [(3S)-15-[tert-butyl(dimethyl)silyl]oxy-20-(4-phenylbutyl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2c(c1)C13CCN(CCCCc4ccccc4)C(C2)C12CCC1C3[C@@H](CN1C(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C42H54N2O2Si/c1-40(2,3)47(4,5)46-34-20-19-32-26-37-41-22-21-36-38(33(28-41)29-44(36)39(45)31-17-10-7-11-18-31)42(41,35(32)27-34)23-25-43(37)24-13-12-16-30-14-8-6-9-15-30/h6-11,14-15,17-20,27,33,36-38H,12-13,16,21-26,28-29H2,1-5H3/t33-,36?,37?,38?,41?,42?/m1/s1 |
| InChIKey | SEQSOIWCJVGHRH-ZBBZXWOVSA-N |
| XLogP | 8.90 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.99 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|