C34H40N4O — CID 90392422
(3S)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-20-(2-phenylethyl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene (PubChem CID 90392422) has the molecular formula C34H40N4O and a molecular weight of 520.72 g/mol. Its IUPAC name is (3S)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-20-(2-phenylethyl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene.
| Compound Name | (3S)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-20-(2-phenylethyl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene |
|---|---|
| PubChem CID | 90392422 |
| Molecular Formula | C34H40N4O |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | (3S)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-20-(2-phenylethyl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene |
| SMILES | COc1ccc2c(c1)C13CCN(CCc4ccccc4)C(C2)C12CCC1C3[C@@H](CN1c1nc(C)cc(C)n1)C2 |
| InChI | InChI=1S/C34H40N4O/c1-22-17-23(2)36-32(35-22)38-21-26-20-33-13-11-29(38)31(26)34(33)14-16-37(15-12-24-7-5-4-6-8-24)30(33)18-25-9-10-27(39-3)19-28(25)34/h4-10,17,19,26,29-31H,11-16,18,20-21H2,1-3H3/t26-,29?,30?,31?,33?,34?/m1/s1 |
| InChIKey | XJBNFZCNJWXZEF-YQNZOWEQSA-N |
| XLogP | 5.52 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |