C31H40N4O3 — CID 121309563
tert-butyl (3S)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-20-carboxylate (PubChem CID 121309563) has the molecular formula C31H40N4O3 and a molecular weight of 516.69 g/mol. Its IUPAC name is tert-butyl (3S)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-20-carboxylate.
| Compound Name | tert-butyl (3S)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-20-carboxylate |
|---|---|
| PubChem CID | 121309563 |
| Molecular Formula | C31H40N4O3 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | tert-butyl (3S)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-20-carboxylate |
| SMILES | COc1ccc2c(c1)C13CCN(C(=O)OC(C)(C)C)C(C2)C12CCC1C3[C@@H](CN1c1nc(C)cc(C)n1)C2 |
| InChI | InChI=1S/C31H40N4O3/c1-18-13-19(2)33-27(32-18)35-17-21-16-30-10-9-24(35)26(21)31(30)11-12-34(28(36)38-29(3,4)5)25(30)14-20-7-8-22(37-6)15-23(20)31/h7-8,13,15,21,24-26H,9-12,14,16-17H2,1-6H3/t21-,24?,25?,26?,30?,31?/m1/s1 |
| InChIKey | UJRJXFKAARVYHL-CAKREVJPSA-N |
| XLogP | 5.21 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |