C28H34N4O2 — CID 89435193
(3S)-20-(cyclopropylmethyl)-5-(5-methoxypyrimidin-2-yl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol (PubChem CID 89435193) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is (3S)-20-(cyclopropylmethyl)-5-(5-methoxypyrimidin-2-yl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol.
| Compound Name | (3S)-20-(cyclopropylmethyl)-5-(5-methoxypyrimidin-2-yl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
|---|---|
| PubChem CID | 89435193 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | (3S)-20-(cyclopropylmethyl)-5-(5-methoxypyrimidin-2-yl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
| SMILES | COc1cnc(N2C[C@H]3CC45CCC2C3C42CCN(CC3CC3)C5Cc3ccc(O)cc32)nc1 |
| InChI | InChI=1S/C28H34N4O2/c1-34-21-13-29-26(30-14-21)32-16-19-12-27-7-6-23(32)25(19)28(27)8-9-31(15-17-2-3-17)24(27)10-18-4-5-20(33)11-22(18)28/h4-5,11,13-14,17,19,23-25,33H,2-3,6-10,12,15-16H2,1H3/t19-,23?,24?,25?,27?,28?/m1/s1 |
| InChIKey | NMHTVBIUKKMGQB-MGXAEFJGSA-N |
| XLogP | 3.77 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |