C30H38N4O — CID 90392440
(3S)-20-(cyclopropylmethyl)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene (PubChem CID 90392440) has the molecular formula C30H38N4O and a molecular weight of 470.66 g/mol. Its IUPAC name is (3S)-20-(cyclopropylmethyl)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene.
| Compound Name | (3S)-20-(cyclopropylmethyl)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene |
|---|---|
| PubChem CID | 90392440 |
| Molecular Formula | C30H38N4O |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | (3S)-20-(cyclopropylmethyl)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene |
| SMILES | COc1ccc2c(c1)C13CCN(CC4CC4)C(C2)C12CCC1C3[C@@H](CN1c1nc(C)cc(C)n1)C2 |
| InChI | InChI=1S/C30H38N4O/c1-18-12-19(2)32-28(31-18)34-17-22-15-29-9-8-25(34)27(22)30(29)10-11-33(16-20-4-5-20)26(29)13-21-6-7-23(35-3)14-24(21)30/h6-7,12,14,20,22,25-27H,4-5,8-11,13,15-17H2,1-3H3/t22-,25?,26?,27?,29?,30?/m1/s1 |
| InChIKey | RAZJLUCXJCAZHM-BXGNEPPVSA-N |
| XLogP | 4.69 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |