C28H36N4O — CID 89435149
(3S)-5-(4,6-dimethylpyrimidin-2-yl)-20-propyl-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol (PubChem CID 89435149) has the molecular formula C28H36N4O and a molecular weight of 444.62 g/mol. Its IUPAC name is (3S)-5-(4,6-dimethylpyrimidin-2-yl)-20-propyl-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol.
| Compound Name | (3S)-5-(4,6-dimethylpyrimidin-2-yl)-20-propyl-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
|---|---|
| PubChem CID | 89435149 |
| Molecular Formula | C28H36N4O |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | (3S)-5-(4,6-dimethylpyrimidin-2-yl)-20-propyl-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
| SMILES | CCCN1CCC23c4cc(O)ccc4CC1C21CCC2C3[C@@H](CN2c2nc(C)cc(C)n2)C1 |
| InChI | InChI=1S/C28H36N4O/c1-4-10-31-11-9-28-22-14-21(33)6-5-19(22)13-24(31)27(28)8-7-23-25(28)20(15-27)16-32(23)26-29-17(2)12-18(3)30-26/h5-6,12,14,20,23-25,33H,4,7-11,13,15-16H2,1-3H3/t20-,23?,24?,25?,27?,28?/m1/s1 |
| InChIKey | ILLNPLCEDOIYEU-FHRHOYQYSA-N |
| XLogP | 4.38 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |