C29H36N4O — CID 71528854
(1R,2S,3S,6S,9S,10R)-20-(cyclopropylmethyl)-5-(4,6-dimethylpyrimidin-2-yl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol (PubChem CID 71528854) has the molecular formula C29H36N4O and a molecular weight of 456.63 g/mol. Its IUPAC name is (1R,2S,3S,6S,9S,10R)-20-(cyclopropylmethyl)-5-(4,6-dimethylpyrimidin-2-yl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol.
| Compound Name | (1R,2S,3S,6S,9S,10R)-20-(cyclopropylmethyl)-5-(4,6-dimethylpyrimidin-2-yl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
|---|---|
| PubChem CID | 71528854 |
| Molecular Formula | C29H36N4O |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | (1R,2S,3S,6S,9S,10R)-20-(cyclopropylmethyl)-5-(4,6-dimethylpyrimidin-2-yl)-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
| SMILES | Cc1cc(C)nc(N2C[C@H]3C[C@@]45CC[C@H]2[C@@H]3[C@@]42CCN(CC3CC3)[C@@H]5Cc3ccc(O)cc32)n1 |
| InChI | InChI=1S/C29H36N4O/c1-17-11-18(2)31-27(30-17)33-16-21-14-28-8-7-24(33)26(21)29(28)9-10-32(15-19-3-4-19)25(28)12-20-5-6-22(34)13-23(20)29/h5-6,11,13,19,21,24-26,34H,3-4,7-10,12,14-16H2,1-2H3/t21-,24+,25-,26-,28-,29+/m1/s1 |
| InChIKey | UWGPZHSUOIKRRY-QMPTZKCSSA-N |
| XLogP | 4.38 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |