C28H32N4O3 — CID 122550923
5-[(3S)-20-(cyclopropylmethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]-1H-pyrazin-2-one (PubChem CID 122550923) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 5-[(3S)-20-(cyclopropylmethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]-1H-pyrazin-2-one.
| Compound Name | 5-[(3S)-20-(cyclopropylmethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 122550923 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 5-[(3S)-20-(cyclopropylmethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carbonyl]-1H-pyrazin-2-one |
| SMILES | O=C(c1c[nH]c(=O)cn1)N1C[C@H]2CC34CCC1C2C31CCN(CC2CC2)C4Cc2ccc(O)cc21 |
| InChI | InChI=1S/C28H32N4O3/c33-19-4-3-17-9-23-27-6-5-22-25(28(27,20(17)10-19)7-8-31(23)14-16-1-2-16)18(11-27)15-32(22)26(35)21-12-30-24(34)13-29-21/h3-4,10,12-13,16,18,22-23,25,33H,1-2,5-9,11,14-15H2,(H,30,34)/t18-,22?,23?,25?,27?,28?/m1/s1 |
| InChIKey | UEUDPTBEVQCTJX-ZKFVLHKPSA-N |
| XLogP | 2.69 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |