C29H35N3O3S — CID 129034824
[(3S)-20-(3-amino-2-hydroxysulfanylpropyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone (PubChem CID 129034824) has the molecular formula C29H35N3O3S and a molecular weight of 505.68 g/mol. Its IUPAC name is [(3S)-20-(3-amino-2-hydroxysulfanylpropyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone.
| Compound Name | [(3S)-20-(3-amino-2-hydroxysulfanylpropyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 129034824 |
| Molecular Formula | C29H35N3O3S |
| Molecular Weight | 505.68 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | [(3S)-20-(3-amino-2-hydroxysulfanylpropyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone |
| SMILES | NCC(CN1CCC23c4cc(O)ccc4CC1C21CCC2C3[C@@H](CN2C(=O)c2ccccc2)C1)SO |
| InChI | InChI=1S/C29H35N3O3S/c30-15-22(36-35)17-31-11-10-29-23-13-21(33)7-6-19(23)12-25(31)28(29)9-8-24-26(29)20(14-28)16-32(24)27(34)18-4-2-1-3-5-18/h1-7,13,20,22,24-26,33,35H,8-12,14-17,30H2/t20-,22?,24?,25?,26?,28?,29?/m1/s1 |
| InChIKey | VCVZRJYBNXZEML-YQISYMAESA-N |
| XLogP | 3.73 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.68 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|