C29H35N3O3 — CID 118643267
[(1R,2S,3S,6R,9S,10R)-20-(3-amino-2-hydroxypropyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone (PubChem CID 118643267) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is [(1R,2S,3S,6R,9S,10R)-20-(3-amino-2-hydroxypropyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone.
| Compound Name | [(1R,2S,3S,6R,9S,10R)-20-(3-amino-2-hydroxypropyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone |
|---|---|
| PubChem CID | 118643267 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | [(1R,2S,3S,6R,9S,10R)-20-(3-amino-2-hydroxypropyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-phenylmethanone |
| SMILES | NCC(O)CN1CC[C@@]23c4cc(O)ccc4C[C@@H]1[C@]21CC[C@@H]2[C@H]3[C@@H](CN2C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C29H35N3O3/c30-15-22(34)17-31-11-10-29-23-13-21(33)7-6-19(23)12-25(31)28(29)9-8-24-26(29)20(14-28)16-32(24)27(35)18-4-2-1-3-5-18/h1-7,13,20,22,24-26,33-34H,8-12,14-17,30H2/t20-,22?,24-,25-,26-,28-,29+/m1/s1 |
| InChIKey | IFVBODFWBLDLIZ-KLFDGIRXSA-N |
| XLogP | 2.52 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |