C29H34ClN3O3 — CID 169430252
[(3S)-20-(cyclopropylmethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-(1-oxidopyridin-1-ium-2-yl)methanone;hydrochloride (PubChem CID 169430252) has the molecular formula C29H34ClN3O3 and a molecular weight of 508.06 g/mol. Its IUPAC name is [(3S)-20-(cyclopropylmethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-(1-oxidopyridin-1-ium-2-yl)methanone;hydrochloride.
| Compound Name | [(3S)-20-(cyclopropylmethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-(1-oxidopyridin-1-ium-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 169430252 |
| Molecular Formula | C29H34ClN3O3 |
| Molecular Weight | 508.06 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | [(3S)-20-(cyclopropylmethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-5-yl]-(1-oxidopyridin-1-ium-2-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1cccc[n+]1[O-])N1C[C@H]2CC34CCC1C2C31CCN(CC2CC2)C4Cc2ccc(O)cc21 |
| InChI | InChI=1S/C29H33N3O3.ClH/c33-21-7-6-19-13-25-28-9-8-23-26(29(28,22(19)14-21)10-12-30(25)16-18-4-5-18)20(15-28)17-31(23)27(34)24-3-1-2-11-32(24)35;/h1-3,6-7,11,14,18,20,23,25-26,33H,4-5,8-10,12-13,15-17H2;1H/t20-,23?,25?,26?,28?,29?;/m1./s1 |
| InChIKey | QDSYQXRDYMRYKY-RPLUJMGTSA-N |
| XLogP | 3.67 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.06 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|