C26H31Cl3N2O3 — CID 151267404
2,2,2-trichloroethyl (1R,2S,3S,6R,9S,10R)-20-(cyclopropylmethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carboxylate (PubChem CID 151267404) has the molecular formula C26H31Cl3N2O3 and a molecular weight of 525.90 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (1R,2S,3S,6R,9S,10R)-20-(cyclopropylmethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (1R,2S,3S,6R,9S,10R)-20-(cyclopropylmethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carboxylate |
|---|---|
| PubChem CID | 151267404 |
| Molecular Formula | C26H31Cl3N2O3 |
| Molecular Weight | 525.90 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 2,2,2-trichloroethyl (1R,2S,3S,6R,9S,10R)-20-(cyclopropylmethyl)-15-hydroxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene-5-carboxylate |
| SMILES | O=C(OCC(Cl)(Cl)Cl)N1C[C@H]2C[C@@]34CC[C@@H]1[C@@H]2[C@@]31CCN(CC2CC2)[C@@H]4Cc2ccc(O)cc21 |
| InChI | InChI=1S/C26H31Cl3N2O3/c27-26(28,29)14-34-23(33)31-13-17-11-24-6-5-20(31)22(17)25(24)7-8-30(12-15-1-2-15)21(24)9-16-3-4-18(32)10-19(16)25/h3-4,10,15,17,20-22,32H,1-2,5-9,11-14H2/t17-,20-,21-,22-,24-,25+/m1/s1 |
| InChIKey | NVQDVCAXTAKOFX-BIBHOBPJSA-N |
| XLogP | 5.28 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.90 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|