C23H32N2O — CID 90392438
(3S)-15-methoxy-20-propyl-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene (PubChem CID 90392438) has the molecular formula C23H32N2O and a molecular weight of 352.52 g/mol. Its IUPAC name is (3S)-15-methoxy-20-propyl-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene.
| Compound Name | (3S)-15-methoxy-20-propyl-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene |
|---|---|
| PubChem CID | 90392438 |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.25 |
| IUPAC Name | (3S)-15-methoxy-20-propyl-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene |
| SMILES | CCCN1CCC23c4cc(OC)ccc4CC1C21CCC2NC[C@@H](C1)C23 |
| InChI | InChI=1S/C23H32N2O/c1-3-9-25-10-8-23-18-12-17(26-2)5-4-15(18)11-20(25)22(23)7-6-19-21(23)16(13-22)14-24-19/h4-5,12,16,19-21,24H,3,6-11,13-14H2,1-2H3/t16-,19?,20?,21?,22?,23?/m1/s1 |
| InChIKey | VPJFRNNUVIODMA-ZCBUIETOSA-N |
| XLogP | 3.36 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |