C23H30N2O — CID 146803899
(3S)-20-cyclobutyl-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol (PubChem CID 146803899) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is (3S)-20-cyclobutyl-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol.
| Compound Name | (3S)-20-cyclobutyl-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
|---|---|
| PubChem CID | 146803899 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (3S)-20-cyclobutyl-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-15-ol |
| SMILES | Oc1ccc2c(c1)C13CCN(C4CCC4)C(C2)C12CCC1NC[C@@H](C2)C13 |
| InChI | InChI=1S/C23H30N2O/c26-17-5-4-14-10-20-22-7-6-19-21(15(12-22)13-24-19)23(22,18(14)11-17)8-9-25(20)16-2-1-3-16/h4-5,11,15-16,19-21,24,26H,1-3,6-10,12-13H2/t15-,19?,20?,21?,22?,23?/m1/s1 |
| InChIKey | RYLOVHKKIFAXBL-JIYDHVSHSA-N |
| XLogP | 3.20 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |