C35H38N2O3 — CID 144564730
(3S)-5-benzyl-15-hydroxy-20-[2-(4-methoxyphenyl)ethyl]-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-4-one (PubChem CID 144564730) has the molecular formula C35H38N2O3 and a molecular weight of 534.70 g/mol. Its IUPAC name is (3S)-5-benzyl-15-hydroxy-20-[2-(4-methoxyphenyl)ethyl]-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-4-one.
| Compound Name | (3S)-5-benzyl-15-hydroxy-20-[2-(4-methoxyphenyl)ethyl]-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-4-one |
|---|---|
| PubChem CID | 144564730 |
| Molecular Formula | C35H38N2O3 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | (3S)-5-benzyl-15-hydroxy-20-[2-(4-methoxyphenyl)ethyl]-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-trien-4-one |
| SMILES | COc1ccc(CCN2CCC34c5cc(O)ccc5CC2C32CCC3C4[C@H](C2)C(=O)N3Cc2ccccc2)cc1 |
| InChI | InChI=1S/C35H38N2O3/c1-40-27-11-7-23(8-12-27)14-17-36-18-16-35-29-20-26(38)10-9-25(29)19-31(36)34(35)15-13-30-32(35)28(21-34)33(39)37(30)22-24-5-3-2-4-6-24/h2-12,20,28,30-32,38H,13-19,21-22H2,1H3/t28-,30?,31?,32?,34?,35?/m0/s1 |
| InChIKey | IBQLHGQNYMGCQG-NLYBRQFASA-N |
| XLogP | 5.34 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |