C26H32N4O — CID 129034811
(3R)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene (PubChem CID 129034811) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is (3R)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene.
| Compound Name | (3R)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene |
|---|---|
| PubChem CID | 129034811 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (3R)-5-(4,6-dimethylpyrimidin-2-yl)-15-methoxy-5,20-diazahexacyclo[8.7.3.13,9.01,9.02,6.012,17]henicosa-12(17),13,15-triene |
| SMILES | COc1ccc2c(c1)C13CCNC(C2)C12CCC1C3[C@H](CN1c1nc(C)cc(C)n1)C2 |
| InChI | InChI=1S/C26H32N4O/c1-15-10-16(2)29-24(28-15)30-14-18-13-25-7-6-21(30)23(18)26(25)8-9-27-22(25)11-17-4-5-19(31-3)12-20(17)26/h4-5,10,12,18,21-23,27H,6-9,11,13-14H2,1-3H3/t18-,21?,22?,23?,25?,26?/m0/s1 |
| InChIKey | UIFYBFWAVQSNKT-HXTZOPKCSA-N |
| XLogP | 3.56 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |