C17H23NO2 — CID 15971096
(1R,9S,10S)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol (PubChem CID 15971096) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (1R,9S,10S)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol.
| Compound Name | (1R,9S,10S)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol |
|---|---|
| PubChem CID | 15971096 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (1R,9S,10S)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol |
| SMILES | COc1ccc2c(c1)[C@]13CCCC[C@@]1(O)[C@H](C2)NCC3 |
| InChI | InChI=1S/C17H23NO2/c1-20-13-5-4-12-10-15-17(19)7-3-2-6-16(17,8-9-18-15)14(12)11-13/h4-5,11,15,18-19H,2-3,6-10H2,1H3/t15-,16+,17+/m0/s1 |
| InChIKey | ZREGHPIWNOPAHK-GVDBMIGSSA-N |
| XLogP | 2.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |