C20H25N3O3 — CID 90228472
(1R,9R,10S,13S)-10-hydroxy-4-methoxy-5'-methylidenespiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,4'-imidazolidine]-2'-one (PubChem CID 90228472) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (1R,9R,10S,13S)-10-hydroxy-4-methoxy-5'-methylidenespiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,4'-imidazolidine]-2'-one.
| Compound Name | (1R,9R,10S,13S)-10-hydroxy-4-methoxy-5'-methylidenespiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,4'-imidazolidine]-2'-one |
|---|---|
| PubChem CID | 90228472 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (1R,9R,10S,13S)-10-hydroxy-4-methoxy-5'-methylidenespiro[17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-13,4'-imidazolidine]-2'-one |
| SMILES | C=C1NC(=O)N[C@]12CC[C@@]1(O)[C@H]3Cc4ccc(OC)cc4[C@@]1(CCN3)C2 |
| InChI | InChI=1S/C20H25N3O3/c1-12-19(23-17(24)22-12)5-6-20(25)16-9-13-3-4-14(26-2)10-15(13)18(20,11-19)7-8-21-16/h3-4,10,16,21,25H,1,5-9,11H2,2H3,(H2,22,23,24)/t16-,18-,19+,20-/m1/s1 |
| InChIKey | VELZCGGDXNZOBQ-RSPOEFSDSA-N |
| XLogP | 1.33 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |