C19H26ClNO3 — CID 70568079
(1R,9R,11S)-4,10-dimethoxy-11-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride (PubChem CID 70568079) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is (1R,9R,11S)-4,10-dimethoxy-11-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride.
| Compound Name | (1R,9R,11S)-4,10-dimethoxy-11-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride |
|---|---|
| PubChem CID | 70568079 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (1R,9R,11S)-4,10-dimethoxy-11-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride |
| SMILES | COc1ccc2c(c1)[C@]13CCN[C@H](C2)C1(OC)[C@@H](C)CC(=O)C3.Cl |
| InChI | InChI=1S/C19H25NO3.ClH/c1-12-8-14(21)11-18-6-7-20-17(19(12,18)23-3)9-13-4-5-15(22-2)10-16(13)18;/h4-5,10,12,17,20H,6-9,11H2,1-3H3;1H/t12-,17+,18+,19?;/m0./s1 |
| InChIKey | ZOTIIVVBWVJQHF-UMZUYKEISA-N |
| XLogP | 2.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |