C19H25NO4 — CID 138395411
(1'R,9'S,10'S)-4'-methoxyspiro[1,3-dioxolane-2,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-10'-ol (PubChem CID 138395411) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is (1'R,9'S,10'S)-4'-methoxyspiro[1,3-dioxolane-2,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-10'-ol.
| Compound Name | (1'R,9'S,10'S)-4'-methoxyspiro[1,3-dioxolane-2,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-10'-ol |
|---|---|
| PubChem CID | 138395411 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (1'R,9'S,10'S)-4'-methoxyspiro[1,3-dioxolane-2,13'-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene]-10'-ol |
| SMILES | COc1ccc2c(c1)[C@]13CCN[C@@H](C2)[C@]1(O)CCC1(C3)OCCO1 |
| InChI | InChI=1S/C19H25NO4/c1-22-14-3-2-13-10-16-19(21)5-4-18(23-8-9-24-18)12-17(19,6-7-20-16)15(13)11-14/h2-3,11,16,20-21H,4-10,12H2,1H3/t16-,17+,19+/m0/s1 |
| InChIKey | IMUVLRIUPLKNQH-YQVWRLOYSA-N |
| XLogP | 1.51 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |