C20H26NO3+ — CID 102578159
(1'R,9'S)-4'-methoxy-11'-methylspiro[1,3-dioxolane-2,15'-11-azoniatetracyclo[7.4.4.01,9.02,7]heptadeca-2(7),3,5,10-tetraene] (PubChem CID 102578159) has the molecular formula C20H26NO3+ and a molecular weight of 328.43 g/mol. Its IUPAC name is (1'R,9'S)-4'-methoxy-11'-methylspiro[1,3-dioxolane-2,15'-11-azoniatetracyclo[7.4.4.01,9.02,7]heptadeca-2(7),3,5,10-tetraene].
| Compound Name | (1'R,9'S)-4'-methoxy-11'-methylspiro[1,3-dioxolane-2,15'-11-azoniatetracyclo[7.4.4.01,9.02,7]heptadeca-2(7),3,5,10-tetraene] |
|---|---|
| PubChem CID | 102578159 |
| Molecular Formula | C20H26NO3+ |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (1'R,9'S)-4'-methoxy-11'-methylspiro[1,3-dioxolane-2,15'-11-azoniatetracyclo[7.4.4.01,9.02,7]heptadeca-2(7),3,5,10-tetraene] |
| SMILES | COc1ccc2c(c1)[C@]13CC[N+](C)=C[C@@]1(CCC1(C3)OCCO1)C2 |
| InChI | InChI=1S/C20H26NO3/c1-21-8-7-19-13-20(23-9-10-24-20)6-5-18(19,14-21)12-15-3-4-16(22-2)11-17(15)19/h3-4,11,14H,5-10,12-13H2,1-2H3/q+1/t18-,19-/m1/s1 |
| InChIKey | FURAKALCRZWXNX-RTBURBONSA-N |
| XLogP | 2.52 |
| TPSA | 30.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|