C21H27NO3 — CID 70603833
[(1S,9R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-yl] cyclopropanecarboxylate (PubChem CID 70603833) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is [(1S,9R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-yl] cyclopropanecarboxylate.
| Compound Name | [(1S,9R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 70603833 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [(1S,9R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-yl] cyclopropanecarboxylate |
| SMILES | COc1ccc2c(c1)[C@@]13CCCCC1(OC(=O)C1CC1)[C@@H](C2)NCC3 |
| InChI | InChI=1S/C21H27NO3/c1-24-16-7-6-15-12-18-21(25-19(23)14-4-5-14)9-3-2-8-20(21,10-11-22-18)17(15)13-16/h6-7,13-14,18,22H,2-5,8-12H2,1H3/t18-,20+,21?/m1/s1 |
| InChIKey | WQCJIUMMMRXMDM-LGWYJFNUSA-N |
| XLogP | 3.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |