C22H29NO7 — CID 70584689
(E)-but-2-enedioic acid;(1S,9R,10S)-4-methoxy-12,12-dimethyl-13-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol (PubChem CID 70584689) has the molecular formula C22H29NO7 and a molecular weight of 419.47 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(1S,9R,10S)-4-methoxy-12,12-dimethyl-13-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol.
| Compound Name | (E)-but-2-enedioic acid;(1S,9R,10S)-4-methoxy-12,12-dimethyl-13-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol |
|---|---|
| PubChem CID | 70584689 |
| Molecular Formula | C22H29NO7 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (E)-but-2-enedioic acid;(1S,9R,10S)-4-methoxy-12,12-dimethyl-13-oxa-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-10-ol |
| SMILES | COc1ccc2c(c1)[C@]13CCN[C@H](C2)[C@]1(O)CC(C)(C)OC3.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C18H25NO3.C4H4O4/c1-16(2)10-18(20)15-8-12-4-5-13(21-3)9-14(12)17(18,11-22-16)6-7-19-15;5-3(6)1-2-4(7)8/h4-5,9,15,19-20H,6-8,10-11H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t15-,17-,18-;/m1./s1 |
| InChIKey | KABJSRNEVRETAJ-WFKUHYQBSA-N |
| XLogP | 1.49 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|