C24H34ClNO3 — CID 70568831
(1R,9R,10S,11S)-17-(cyclobutylmethyl)-4,10-dimethoxy-11-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride (PubChem CID 70568831) has the molecular formula C24H34ClNO3 and a molecular weight of 419.99 g/mol. Its IUPAC name is (1R,9R,10S,11S)-17-(cyclobutylmethyl)-4,10-dimethoxy-11-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride.
| Compound Name | (1R,9R,10S,11S)-17-(cyclobutylmethyl)-4,10-dimethoxy-11-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride |
|---|---|
| PubChem CID | 70568831 |
| Molecular Formula | C24H34ClNO3 |
| Molecular Weight | 419.99 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (1R,9R,10S,11S)-17-(cyclobutylmethyl)-4,10-dimethoxy-11-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-13-one;hydrochloride |
| SMILES | COc1ccc2c(c1)[C@]13CCN(CC4CCC4)[C@H](C2)[C@]1(OC)[C@@H](C)CC(=O)C3.Cl |
| InChI | InChI=1S/C24H33NO3.ClH/c1-16-11-19(26)14-23-9-10-25(15-17-5-4-6-17)22(24(16,23)28-3)12-18-7-8-20(27-2)13-21(18)23;/h7-8,13,16-17,22H,4-6,9-12,14-15H2,1-3H3;1H/t16-,22+,23+,24+;/m0./s1 |
| InChIKey | DCLUOOMZSHWRNQ-VURRHGJASA-N |
| XLogP | 4.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.99 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |