C29H43NO6S2 — CID 166678248
5-[1-[3-[(7R,9S,14S)-7-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propanoylamino]propyl]thiophene-2-sulfonic acid (PubChem CID 166678248) has the molecular formula C29H43NO6S2 and a molecular weight of 565.80 g/mol. Its IUPAC name is 5-[1-[3-[(7R,9S,14S)-7-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propanoylamino]propyl]thiophene-2-sulfonic acid.
| Compound Name | 5-[1-[3-[(7R,9S,14S)-7-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propanoylamino]propyl]thiophene-2-sulfonic acid |
|---|---|
| PubChem CID | 166678248 |
| Molecular Formula | C29H43NO6S2 |
| Molecular Weight | 565.80 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | 5-[1-[3-[(7R,9S,14S)-7-hydroxy-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]propanoylamino]propyl]thiophene-2-sulfonic acid |
| SMILES | CCC(NC(=O)CCC1CC[C@H]2C3C(O)CC4CC(=O)CCC4(C)[C@H]3CCC12C)c1ccc(S(=O)(=O)O)s1 |
| InChI | InChI=1S/C29H43NO6S2/c1-4-22(24-8-10-26(37-24)38(34,35)36)30-25(33)9-6-17-5-7-20-27-21(12-14-28(17,20)2)29(3)13-11-19(31)15-18(29)16-23(27)32/h8,10,17-18,20-23,27,32H,4-7,9,11-16H2,1-3H3,(H,30,33)(H,34,35,36)/t17?,18?,20-,21-,22?,23?,27?,28?,29?/m0/s1 |
| InChIKey | QBAFCNZJICMRSR-YRHKHHLRSA-N |
| XLogP | 5.54 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.80 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|