C17H21N5O — CID 16667902
1-(4,11,13-trimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-yl)piperidin-3-ol (PubChem CID 16667902) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-(4,11,13-trimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-yl)piperidin-3-ol.
| Compound Name | 1-(4,11,13-trimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-yl)piperidin-3-ol |
|---|---|
| PubChem CID | 16667902 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-(4,11,13-trimethyl-3,7,8,10-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8,10,12-hexaen-6-yl)piperidin-3-ol |
| SMILES | Cc1cc(C)c2c(n1)nn1c(N3CCCC(O)C3)cc(C)nc21 |
| InChI | InChI=1S/C17H21N5O/c1-10-7-11(2)18-16-15(10)17-19-12(3)8-14(22(17)20-16)21-6-4-5-13(23)9-21/h7-8,13,23H,4-6,9H2,1-3H3 |
| InChIKey | NOXKQRCSJNUDGB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |