C31H33Cl2N3O7S — CID 166679678
5-[[4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]phenyl]-formylsulfamoyl]pentanoic acid (PubChem CID 166679678) has the molecular formula C31H33Cl2N3O7S and a molecular weight of 662.59 g/mol. Its IUPAC name is 5-[[4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]phenyl]-formylsulfamoyl]pentanoic acid.
| Compound Name | 5-[[4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]phenyl]-formylsulfamoyl]pentanoic acid |
|---|---|
| PubChem CID | 166679678 |
| Molecular Formula | C31H33Cl2N3O7S |
| Molecular Weight | 662.59 g/mol |
| Exact Mass | 661.14 |
| IUPAC Name | 5-[[4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]phenyl]-formylsulfamoyl]pentanoic acid |
| SMILES | O=CN(c1ccc(N2C[C@@H]3C[C@H]2C[C@H]3OCc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)cc1)S(=O)(=O)CCCCC(=O)O |
| InChI | InChI=1S/C31H33Cl2N3O7S/c32-25-4-3-5-26(33)29(25)30-24(31(43-34-30)19-7-8-19)17-42-27-15-23-14-20(27)16-35(23)21-9-11-22(12-10-21)36(18-37)44(40,41)13-2-1-6-28(38)39/h3-5,9-12,18-20,23,27H,1-2,6-8,13-17H2,(H,38,39)/t20-,23-,27+/m0/s1 |
| InChIKey | VKXVBGOZQDZTGC-XAJLNHFYSA-N |
| XLogP | 6.26 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.59 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|