C18H24N2O6S — CID 166679841
3-methoxy-4-[3-(6-oxa-1-azaspiro[3.3]heptan-1-ylsulfonylmethyl)phenoxy]pyrrolidine-1-carbaldehyde (PubChem CID 166679841) has the molecular formula C18H24N2O6S and a molecular weight of 396.47 g/mol. Its IUPAC name is 3-methoxy-4-[3-(6-oxa-1-azaspiro[3.3]heptan-1-ylsulfonylmethyl)phenoxy]pyrrolidine-1-carbaldehyde.
| Compound Name | 3-methoxy-4-[3-(6-oxa-1-azaspiro[3.3]heptan-1-ylsulfonylmethyl)phenoxy]pyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 166679841 |
| Molecular Formula | C18H24N2O6S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 3-methoxy-4-[3-(6-oxa-1-azaspiro[3.3]heptan-1-ylsulfonylmethyl)phenoxy]pyrrolidine-1-carbaldehyde |
| SMILES | COC1CN(C=O)CC1Oc1cccc(CS(=O)(=O)N2CCC23COC3)c1 |
| InChI | InChI=1S/C18H24N2O6S/c1-24-16-8-19(13-21)9-17(16)26-15-4-2-3-14(7-15)10-27(22,23)20-6-5-18(20)11-25-12-18/h2-4,7,13,16-17H,5-6,8-12H2,1H3 |
| InChIKey | CYSWHFMLQWIPNK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|