C22H27N3O5S — CID 153321445
(3R,4R)-3-methoxy-4-[3-[[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]sulfonylmethyl]phenoxy]pyrrolidine-1-carbaldehyde (PubChem CID 153321445) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is (3R,4R)-3-methoxy-4-[3-[[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]sulfonylmethyl]phenoxy]pyrrolidine-1-carbaldehyde.
| Compound Name | (3R,4R)-3-methoxy-4-[3-[[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]sulfonylmethyl]phenoxy]pyrrolidine-1-carbaldehyde |
|---|---|
| PubChem CID | 153321445 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | (3R,4R)-3-methoxy-4-[3-[[(2S)-2-pyridin-2-ylpyrrolidin-1-yl]sulfonylmethyl]phenoxy]pyrrolidine-1-carbaldehyde |
| SMILES | CO[C@@H]1CN(C=O)C[C@H]1Oc1cccc(CS(=O)(=O)N2CCC[C@H]2c2ccccn2)c1 |
| InChI | InChI=1S/C22H27N3O5S/c1-29-21-13-24(16-26)14-22(21)30-18-7-4-6-17(12-18)15-31(27,28)25-11-5-9-20(25)19-8-2-3-10-23-19/h2-4,6-8,10,12,16,20-22H,5,9,11,13-15H2,1H3/t20-,21+,22+/m0/s1 |
| InChIKey | SOZBEFTUBLTSSR-BHDDXSALSA-N |
| XLogP | 1.98 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|