C22H27N3O6S — CID 155647292
[2-methoxy-3-[(2-pyridin-2-ylpyrrolidin-1-yl)sulfonylmethyl]phenyl] pyrrolidine-1-carboperoxoate (PubChem CID 155647292) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is [2-methoxy-3-[(2-pyridin-2-ylpyrrolidin-1-yl)sulfonylmethyl]phenyl] pyrrolidine-1-carboperoxoate.
| Compound Name | [2-methoxy-3-[(2-pyridin-2-ylpyrrolidin-1-yl)sulfonylmethyl]phenyl] pyrrolidine-1-carboperoxoate |
|---|---|
| PubChem CID | 155647292 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [2-methoxy-3-[(2-pyridin-2-ylpyrrolidin-1-yl)sulfonylmethyl]phenyl] pyrrolidine-1-carboperoxoate |
| SMILES | COc1c(CS(=O)(=O)N2CCCC2c2ccccn2)cccc1OOC(=O)N1CCCC1 |
| InChI | InChI=1S/C22H27N3O6S/c1-29-21-17(8-6-11-20(21)30-31-22(26)24-13-4-5-14-24)16-32(27,28)25-15-7-10-19(25)18-9-2-3-12-23-18/h2-3,6,8-9,11-12,19H,4-5,7,10,13-16H2,1H3 |
| InChIKey | UGDMDNSAKCTGCO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|