C24H33N3O — CID 166680155
2-(aminomethyl)-1-[4-(methylamino)-4-phenylpiperidin-1-yl]-3-phenylpentan-1-one (PubChem CID 166680155) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 2-(aminomethyl)-1-[4-(methylamino)-4-phenylpiperidin-1-yl]-3-phenylpentan-1-one.
| Compound Name | 2-(aminomethyl)-1-[4-(methylamino)-4-phenylpiperidin-1-yl]-3-phenylpentan-1-one |
|---|---|
| PubChem CID | 166680155 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 2-(aminomethyl)-1-[4-(methylamino)-4-phenylpiperidin-1-yl]-3-phenylpentan-1-one |
| SMILES | CCC(c1ccccc1)C(CN)C(=O)N1CCC(NC)(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H33N3O/c1-3-21(19-10-6-4-7-11-19)22(18-25)23(28)27-16-14-24(26-2,15-17-27)20-12-8-5-9-13-20/h4-13,21-22,26H,3,14-18,25H2,1-2H3 |
| InChIKey | MHVGDRHTBWHXMG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |