C25H29N5O4S — CID 166683144
1-[[(2S,3R)-3-ethyl-5-oxopyrrolidin-2-yl]methoxy]-7-propan-2-yloxy-4-(pyridin-3-ylsulfanylamino)isoquinoline-6-carboxamide (PubChem CID 166683144) has the molecular formula C25H29N5O4S and a molecular weight of 495.61 g/mol. Its IUPAC name is 1-[[(2S,3R)-3-ethyl-5-oxopyrrolidin-2-yl]methoxy]-7-propan-2-yloxy-4-(pyridin-3-ylsulfanylamino)isoquinoline-6-carboxamide.
| Compound Name | 1-[[(2S,3R)-3-ethyl-5-oxopyrrolidin-2-yl]methoxy]-7-propan-2-yloxy-4-(pyridin-3-ylsulfanylamino)isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 166683144 |
| Molecular Formula | C25H29N5O4S |
| Molecular Weight | 495.61 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 1-[[(2S,3R)-3-ethyl-5-oxopyrrolidin-2-yl]methoxy]-7-propan-2-yloxy-4-(pyridin-3-ylsulfanylamino)isoquinoline-6-carboxamide |
| SMILES | CC[C@@H]1CC(=O)N[C@@H]1COc1ncc(NSc2cccnc2)c2cc(C(N)=O)c(OC(C)C)cc12 |
| InChI | InChI=1S/C25H29N5O4S/c1-4-15-8-23(31)29-21(15)13-33-25-18-10-22(34-14(2)3)19(24(26)32)9-17(18)20(12-28-25)30-35-16-6-5-7-27-11-16/h5-7,9-12,14-15,21,30H,4,8,13H2,1-3H3,(H2,26,32)(H,29,31)/t15-,21-/m1/s1 |
| InChIKey | KNRBINLONPTYSB-QVKFZJNVSA-N |
| XLogP | 3.93 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.61 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|